C31H34O4S — CID 118406558
2-(2-ethoxyethylsulfanyl)-1-[4-(6-methoxynaphthalen-2-yl)oxynaphthalen-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 118406558) has the molecular formula C31H34O4S and a molecular weight of 502.68 g/mol. Its IUPAC name is 2-(2-ethoxyethylsulfanyl)-1-[4-(6-methoxynaphthalen-2-yl)oxynaphthalen-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 2-(2-ethoxyethylsulfanyl)-1-[4-(6-methoxynaphthalen-2-yl)oxynaphthalen-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 118406558 |
| Molecular Formula | C31H34O4S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 2-(2-ethoxyethylsulfanyl)-1-[4-(6-methoxynaphthalen-2-yl)oxynaphthalen-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | CCOCCSC(C(=O)c1ccc(Oc2ccc3cc(OC)ccc3c2)c2ccccc12)C(C)(C)C |
| InChI | InChI=1S/C31H34O4S/c1-6-34-17-18-36-30(31(2,3)4)29(32)27-15-16-28(26-10-8-7-9-25(26)27)35-24-14-12-21-19-23(33-5)13-11-22(21)20-24/h7-16,19-20,30H,6,17-18H2,1-5H3 |
| InChIKey | KZUXTDNNAPKURO-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|