About (5,7-dioxobenzo[d][2]benzazepin-6-yl) naphthalene-2-sulfonate
(5,7-dioxobenzo[d][2]benzazepin-6-yl) naphthalene-2-sulfonate (PubChem CID 118409291) has the molecular formula C24H15NO5S
and a molecular weight of 429.45 g/mol. Its IUPAC name is (5,7-dioxobenzo[d][2]benzazepin-6-yl) naphthalene-2-sulfonate.
Molecular Properties
| Compound Name | (5,7-dioxobenzo[d][2]benzazepin-6-yl) naphthalene-2-sulfonate |
| PubChem CID | 118409291 |
| Molecular Formula | C24H15NO5S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | (5,7-dioxobenzo[d][2]benzazepin-6-yl) naphthalene-2-sulfonate |
| SMILES | O=c1c2ccccc2c2ccccc2c(=O)n1OS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H15NO5S/c26-23-21-11-5-3-9-19(21)20-10-4-6-12-22(20)24(27)25(23)30-31(28,29)18-14-13-16-7-1-2-8-17(16)15-18/h1-15H |
| InChIKey | KNYIRKZQOPBSPB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 82.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5,7-dioxobenzo[d][2]benzazepin-6-yl) naphthalene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,7-dioxobenzo[d][2]benzazepin-6-yl) naphthalene-2-sulfonate?
The IUPAC name of (5,7-dioxobenzo[d][2]benzazepin-6-yl) naphthalene-2-sulfonate (CID 118409291) is (5,7-dioxobenzo[d][2]benzazepin-6-yl) naphthalene-2-sulfonate.
What is the SMILES notation for (5,7-dioxobenzo[d][2]benzazepin-6-yl) naphthalene-2-sulfonate?
The canonical SMILES for (5,7-dioxobenzo[d][2]benzazepin-6-yl) naphthalene-2-sulfonate is O=c1c2ccccc2c2ccccc2c(=O)n1OS(=O)(=O)c1ccc2ccccc2c1.
What is the InChIKey of (5,7-dioxobenzo[d][2]benzazepin-6-yl) naphthalene-2-sulfonate?
The InChIKey is KNYIRKZQOPBSPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15NO5S/c26-23-21-11-5-3-9-19(21)20-10-4-6-12-22(20)24(27)25(23)30-31(28,29)18-14-13-16-7-1-2-8-17(16)15-18/h1-15H.
What are the key properties of (5,7-dioxobenzo[d][2]benzazepin-6-yl) naphthalene-2-sulfonate?
(5,7-dioxobenzo[d][2]benzazepin-6-yl) naphthalene-2-sulfonate has a molecular weight of 429.45 g/mol, XLogP of 3.49, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5,7-dioxobenzo[d][2]benzazepin-6-yl) naphthalene-2-sulfonate is sourced from PubChem (CID 118409291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).