C24H38O7 — CID 118424488
[4-(oxaldehydoyloxymethyl)cyclohexyl] 4-[(4-methylcyclohexyl)oxymethoxy]cyclohexane-1-carboxylate (PubChem CID 118424488) has the molecular formula C24H38O7 and a molecular weight of 438.56 g/mol. Its IUPAC name is [4-(oxaldehydoyloxymethyl)cyclohexyl] 4-[(4-methylcyclohexyl)oxymethoxy]cyclohexane-1-carboxylate.
| Compound Name | [4-(oxaldehydoyloxymethyl)cyclohexyl] 4-[(4-methylcyclohexyl)oxymethoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118424488 |
| Molecular Formula | C24H38O7 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | [4-(oxaldehydoyloxymethyl)cyclohexyl] 4-[(4-methylcyclohexyl)oxymethoxy]cyclohexane-1-carboxylate |
| SMILES | CC1CCC(OCOC2CCC(C(=O)OC3CCC(COC(=O)C=O)CC3)CC2)CC1 |
| InChI | InChI=1S/C24H38O7/c1-17-2-8-20(9-3-17)29-16-30-21-12-6-19(7-13-21)24(27)31-22-10-4-18(5-11-22)15-28-23(26)14-25/h14,17-22H,2-13,15-16H2,1H3 |
| InChIKey | MZNRYALMKZYKAU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|