C20H24N4O5 — CID 118425108
tert-butyl 1-(1,3-benzoxazol-5-yl)-3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate (PubChem CID 118425108) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is tert-butyl 1-(1,3-benzoxazol-5-yl)-3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 1-(1,3-benzoxazol-5-yl)-3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 118425108 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | tert-butyl 1-(1,3-benzoxazol-5-yl)-3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| SMILES | CN1C(=O)N(c2ccc3ocnc3c2)C2(CCN(C(=O)OC(C)(C)C)CC2)C1=O |
| InChI | InChI=1S/C20H24N4O5/c1-19(2,3)29-18(27)23-9-7-20(8-10-23)16(25)22(4)17(26)24(20)13-5-6-15-14(11-13)21-12-28-15/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | MRNNILOUSRRAFP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 96.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|