C39H56O8 — CID 118439311
benzyl (3R,4R,6S)-4,6-dimethyl-5-phenylmethoxy-3-[(2S,5R,6S)-4,5,6-trimethyl-3-[(2S,5R,6S)-3,4,5,6-tetramethyloxan-2-yl]oxyoxan-2-yl]oxyoxane-2-carboxylate (PubChem CID 118439311) has the molecular formula C39H56O8 and a molecular weight of 652.87 g/mol. Its IUPAC name is benzyl (3R,4R,6S)-4,6-dimethyl-5-phenylmethoxy-3-[(2S,5R,6S)-4,5,6-trimethyl-3-[(2S,5R,6S)-3,4,5,6-tetramethyloxan-2-yl]oxyoxan-2-yl]oxyoxane-2-carboxylate.
| Compound Name | benzyl (3R,4R,6S)-4,6-dimethyl-5-phenylmethoxy-3-[(2S,5R,6S)-4,5,6-trimethyl-3-[(2S,5R,6S)-3,4,5,6-tetramethyloxan-2-yl]oxyoxan-2-yl]oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 118439311 |
| Molecular Formula | C39H56O8 |
| Molecular Weight | 652.87 g/mol |
| Exact Mass | 652.40 |
| IUPAC Name | benzyl (3R,4R,6S)-4,6-dimethyl-5-phenylmethoxy-3-[(2S,5R,6S)-4,5,6-trimethyl-3-[(2S,5R,6S)-3,4,5,6-tetramethyloxan-2-yl]oxyoxan-2-yl]oxyoxane-2-carboxylate |
| SMILES | CC1C(C)[C@@H](C)[C@H](C)O[C@H]1OC1C(C)[C@@H](C)[C@H](C)O[C@H]1O[C@H]1C(C(=O)OCc2ccccc2)O[C@@H](C)C(OCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C39H56O8/c1-22-23(2)28(7)44-38(26(22)5)47-35-25(4)24(3)29(8)45-39(35)46-34-27(6)33(41-20-31-16-12-10-13-17-31)30(9)43-36(34)37(40)42-21-32-18-14-11-15-19-32/h10-19,22-30,33-36,38-39H,20-21H2,1-9H3/t22?,23-,24-,25?,26?,27-,28+,29+,30+,33?,34-,35?,36?,38+,39+/m1/s1 |
| InChIKey | VYQYDECZVDCKJA-FLKXMKRFSA-N |
| XLogP | 7.18 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.87 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |