C12H22N2O — CID 118439844
(2S)-2-amino-N-[(2E,4Z)-hepta-2,4-dienyl]pentanamide (PubChem CID 118439844) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2E,4Z)-hepta-2,4-dienyl]pentanamide.
| Compound Name | (2S)-2-amino-N-[(2E,4Z)-hepta-2,4-dienyl]pentanamide |
|---|---|
| PubChem CID | 118439844 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (2S)-2-amino-N-[(2E,4Z)-hepta-2,4-dienyl]pentanamide |
| SMILES | CC/C=C\C=C\CNC(=O)[C@@H](N)CCC |
| InChI | InChI=1S/C12H22N2O/c1-3-5-6-7-8-10-14-12(15)11(13)9-4-2/h5-8,11H,3-4,9-10,13H2,1-2H3,(H,14,15)/b6-5-,8-7+/t11-/m0/s1 |
| InChIKey | LZZUYMDEJFHSGY-XUZWOMTRSA-N |
| XLogP | 1.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|