C14H24F3N3O — CID 164530481
(2S)-2,6-diamino-N-[(Z,2Z)-2-(1,1,1-trifluoropropan-2-ylidene)pent-3-enyl]hexanamide (PubChem CID 164530481) has the molecular formula C14H24F3N3O and a molecular weight of 307.36 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[(Z,2Z)-2-(1,1,1-trifluoropropan-2-ylidene)pent-3-enyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[(Z,2Z)-2-(1,1,1-trifluoropropan-2-ylidene)pent-3-enyl]hexanamide |
|---|---|
| PubChem CID | 164530481 |
| Molecular Formula | C14H24F3N3O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (2S)-2,6-diamino-N-[(Z,2Z)-2-(1,1,1-trifluoropropan-2-ylidene)pent-3-enyl]hexanamide |
| SMILES | C/C=C\C(CNC(=O)[C@@H](N)CCCCN)=C(/C)C(F)(F)F |
| InChI | InChI=1S/C14H24F3N3O/c1-3-6-11(10(2)14(15,16)17)9-20-13(21)12(19)7-4-5-8-18/h3,6,12H,4-5,7-9,18-19H2,1-2H3,(H,20,21)/b6-3-,11-10-/t12-/m0/s1 |
| InChIKey | HXZYNSCFFALLFU-SPJWHMCMSA-N |
| XLogP | 2.01 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|