C11H16O2 — CID 118440325
2-[[(3E,5Z)-octa-3,5,7-trien-3-yl]oxymethyl]oxirane (PubChem CID 118440325) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-[[(3E,5Z)-octa-3,5,7-trien-3-yl]oxymethyl]oxirane.
| Compound Name | 2-[[(3E,5Z)-octa-3,5,7-trien-3-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 118440325 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-[[(3E,5Z)-octa-3,5,7-trien-3-yl]oxymethyl]oxirane |
| SMILES | C=C/C=C\C=C(/CC)OCC1CO1 |
| InChI | InChI=1S/C11H16O2/c1-3-5-6-7-10(4-2)12-8-11-9-13-11/h3,5-7,11H,1,4,8-9H2,2H3/b6-5-,10-7+ |
| InChIKey | KWDKWLDHSQYCMD-ZZWPSLBBSA-N |
| XLogP | 2.44 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|