C15H24O2 — CID 89361605
2-[[(2E,5Z)-4,4,8-trimethylnona-2,5,8-trien-2-yl]oxymethyl]oxirane (PubChem CID 89361605) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 2-[[(2E,5Z)-4,4,8-trimethylnona-2,5,8-trien-2-yl]oxymethyl]oxirane.
| Compound Name | 2-[[(2E,5Z)-4,4,8-trimethylnona-2,5,8-trien-2-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 89361605 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2-[[(2E,5Z)-4,4,8-trimethylnona-2,5,8-trien-2-yl]oxymethyl]oxirane |
| SMILES | C=C(C)C/C=C\C(C)(C)/C=C(\C)OCC1CO1 |
| InChI | InChI=1S/C15H24O2/c1-12(2)7-6-8-15(4,5)9-13(3)16-10-14-11-17-14/h6,8-9,14H,1,7,10-11H2,2-5H3/b8-6-,13-9+ |
| InChIKey | ANIRROJIKGDHOU-NGRYOTTMSA-N |
| XLogP | 3.85 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|