C19H29N7O2 — CID 118441581
ethyl 2-(6-azidohexylamino)-4-(hex-5-ynylamino)pyrimidine-5-carboxylate (PubChem CID 118441581) has the molecular formula C19H29N7O2 and a molecular weight of 387.49 g/mol. Its IUPAC name is ethyl 2-(6-azidohexylamino)-4-(hex-5-ynylamino)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(6-azidohexylamino)-4-(hex-5-ynylamino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 118441581 |
| Molecular Formula | C19H29N7O2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | ethyl 2-(6-azidohexylamino)-4-(hex-5-ynylamino)pyrimidine-5-carboxylate |
| SMILES | C#CCCCCNc1nc(NCCCCCCN=[N+]=[N-])ncc1C(=O)OCC |
| InChI | InChI=1S/C19H29N7O2/c1-3-5-6-9-12-21-17-16(18(27)28-4-2)15-23-19(25-17)22-13-10-7-8-11-14-24-26-20/h1,15H,4-14H2,2H3,(H2,21,22,23,25) |
| InChIKey | COBXPDAXRADZDU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 124.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|