C18H10F2IN3O — CID 118449913
2-(5,6-difluoro-1H-indol-3-yl)-N-iodoquinoline-5-carboxamide (PubChem CID 118449913) has the molecular formula C18H10F2IN3O and a molecular weight of 449.20 g/mol. Its IUPAC name is 2-(5,6-difluoro-1H-indol-3-yl)-N-iodoquinoline-5-carboxamide.
| Compound Name | 2-(5,6-difluoro-1H-indol-3-yl)-N-iodoquinoline-5-carboxamide |
|---|---|
| PubChem CID | 118449913 |
| Molecular Formula | C18H10F2IN3O |
| Molecular Weight | 449.20 g/mol |
| Exact Mass | 448.98 |
| IUPAC Name | 2-(5,6-difluoro-1H-indol-3-yl)-N-iodoquinoline-5-carboxamide |
| SMILES | O=C(NI)c1cccc2nc(-c3c[nH]c4cc(F)c(F)cc34)ccc12 |
| InChI | InChI=1S/C18H10F2IN3O/c19-13-6-11-12(8-22-17(11)7-14(13)20)16-5-4-9-10(18(25)24-21)2-1-3-15(9)23-16/h1-8,22H,(H,24,25) |
| InChIKey | UMLKWCCXTWOSMH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.20 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|