C20H12F5N3O — CID 164615514
N-(2,2-difluoroethyl)-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide (PubChem CID 164615514) has the molecular formula C20H12F5N3O and a molecular weight of 405.33 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide |
|---|---|
| PubChem CID | 164615514 |
| Molecular Formula | C20H12F5N3O |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide |
| SMILES | O=C(NCC(F)F)c1cccc2nc(-c3c[nH]c4c(F)c(F)c(F)cc34)ccc12 |
| InChI | InChI=1S/C20H12F5N3O/c21-13-6-11-12(7-26-19(11)18(25)17(13)24)15-5-4-9-10(2-1-3-14(9)28-15)20(29)27-8-16(22)23/h1-7,16,26H,8H2,(H,27,29) |
| InChIKey | AUYBVTGNIFEQKZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|