C20H15F2N3O — CID 118449048
2-(5,6-difluoro-7-methyl-1H-indol-3-yl)-N-methylquinoline-5-carboxamide (PubChem CID 118449048) has the molecular formula C20H15F2N3O and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-(5,6-difluoro-7-methyl-1H-indol-3-yl)-N-methylquinoline-5-carboxamide.
| Compound Name | 2-(5,6-difluoro-7-methyl-1H-indol-3-yl)-N-methylquinoline-5-carboxamide |
|---|---|
| PubChem CID | 118449048 |
| Molecular Formula | C20H15F2N3O |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-(5,6-difluoro-7-methyl-1H-indol-3-yl)-N-methylquinoline-5-carboxamide |
| SMILES | CNC(=O)c1cccc2nc(-c3c[nH]c4c(C)c(F)c(F)cc34)ccc12 |
| InChI | InChI=1S/C20H15F2N3O/c1-10-18(22)15(21)8-13-14(9-24-19(10)13)17-7-6-11-12(20(26)23-2)4-3-5-16(11)25-17/h3-9,24H,1-2H3,(H,23,26) |
| InChIKey | FOPXSCJSVAVXRT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |