C21H14FN3O — CID 126503010
2-(7-ethynyl-5-fluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide (PubChem CID 126503010) has the molecular formula C21H14FN3O and a molecular weight of 343.36 g/mol. Its IUPAC name is 2-(7-ethynyl-5-fluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide.
| Compound Name | 2-(7-ethynyl-5-fluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide |
|---|---|
| PubChem CID | 126503010 |
| Molecular Formula | C21H14FN3O |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-(7-ethynyl-5-fluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide |
| SMILES | C#Cc1cc(F)cc2c(-c3ccc4c(C(=O)NC)cccc4n3)c[nH]c12 |
| InChI | InChI=1S/C21H14FN3O/c1-3-12-9-13(22)10-16-17(11-24-20(12)16)19-8-7-14-15(21(26)23-2)5-4-6-18(14)25-19/h1,4-11,24H,2H3,(H,23,26) |
| InChIKey | VEMVMGBPGAPWQV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|