C22H18F3N3O — CID 164616875
N-tert-butyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide (PubChem CID 164616875) has the molecular formula C22H18F3N3O and a molecular weight of 397.40 g/mol. Its IUPAC name is N-tert-butyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide.
| Compound Name | N-tert-butyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide |
|---|---|
| PubChem CID | 164616875 |
| Molecular Formula | C22H18F3N3O |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-tert-butyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1cccc2nc(-c3c[nH]c4c(F)c(F)c(F)cc34)ccc12 |
| InChI | InChI=1S/C22H18F3N3O/c1-22(2,3)28-21(29)12-5-4-6-16-11(12)7-8-17(27-16)14-10-26-20-13(14)9-15(23)18(24)19(20)25/h4-10,26H,1-3H3,(H,28,29) |
| InChIKey | PIUYKMGEKSNCLH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|