C34H35ClN2P2 — CID 11845879
(tert-butylamino)-diphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium chloride (PubChem CID 11845879) has the molecular formula C34H35ClN2P2 and a molecular weight of 569.07 g/mol. Its IUPAC name is (tert-butylamino)-diphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium chloride.
| Compound Name | (tert-butylamino)-diphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium chloride |
|---|---|
| PubChem CID | 11845879 |
| Molecular Formula | C34H35ClN2P2 |
| Molecular Weight | 569.07 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | (tert-butylamino)-diphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium chloride |
| SMILES | CC(C)(C)N[P+](N=P(c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C34H35N2P2.ClH/c1-34(2,3)35-38(32-25-15-7-16-26-32,33-27-17-8-18-28-33)36-37(29-19-9-4-10-20-29,30-21-11-5-12-22-30)31-23-13-6-14-24-31;/h4-28,35H,1-3H3;1H/q+1;/p-1 |
| InChIKey | VGMLISYSGDYRDL-UHFFFAOYSA-M |
| XLogP | 4.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.07 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|