C87H75N4O2P5 — CID 174241416
4-[2-(4-hydroxyphenyl)propan-2-yl]phenolate;tetrakis[(triphenyl-λ5-phosphanylidene)amino]phosphanium (PubChem CID 174241416) has the molecular formula C87H75N4O2P5 and a molecular weight of 1363.45 g/mol. Its IUPAC name is 4-[2-(4-hydroxyphenyl)propan-2-yl]phenolate;tetrakis[(triphenyl-λ5-phosphanylidene)amino]phosphanium.
| Compound Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenolate;tetrakis[(triphenyl-λ5-phosphanylidene)amino]phosphanium |
|---|---|
| PubChem CID | 174241416 |
| Molecular Formula | C87H75N4O2P5 |
| Molecular Weight | 1363.45 g/mol |
| Exact Mass | 1362.46 |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenolate;tetrakis[(triphenyl-λ5-phosphanylidene)amino]phosphanium |
| SMILES | CC(C)(c1ccc([O-])cc1)c1ccc(O)cc1.c1ccc(P(=N[P+](N=P(c2ccccc2)(c2ccccc2)c2ccccc2)(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)N=P(c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C72H60N4P5.C15H16O2/c1-13-37-61(38-14-1)77(62-39-15-2-16-40-62,63-41-17-3-18-42-63)73-81(74-78(64-43-19-4-20-44-64,65-45-21-5-22-46-65)66-47-23-6-24-48-66,75-79(67-49-25-7-26-50-67,68-51-27-8-28-52-68)69-53-29-9-30-54-69)76-80(70-55-31-10-32-56-70,71-57-33-11-34-58-71)72-59-35-12-36-60-72;1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12/h1-60H;3-10,16-17H,1-2H3/q+1;/p-1 |
| InChIKey | LUZUGKGSGZGHEM-UHFFFAOYSA-M |
| XLogP | 18.17 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 98 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1363.45 |
| LogP ≤ 5 | 18.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|