C15H20NO2+ — CID 118460308
2,4-di(propan-2-yl)isoquinolin-2-ium-5,6-diol (PubChem CID 118460308) has the molecular formula C15H20NO2+ and a molecular weight of 246.33 g/mol. Its IUPAC name is 2,4-di(propan-2-yl)isoquinolin-2-ium-5,6-diol.
| Compound Name | 2,4-di(propan-2-yl)isoquinolin-2-ium-5,6-diol |
|---|---|
| PubChem CID | 118460308 |
| Molecular Formula | C15H20NO2+ |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2,4-di(propan-2-yl)isoquinolin-2-ium-5,6-diol |
| SMILES | CC(C)c1c[n+](C(C)C)cc2ccc(O)c(O)c12 |
| InChI | InChI=1S/C15H19NO2/c1-9(2)12-8-16(10(3)4)7-11-5-6-13(17)15(18)14(11)12/h5-10,18H,1-4H3/p+1 |
| InChIKey | GZTXOGVNSMTSMP-UHFFFAOYSA-O |
| XLogP | 3.24 |
| TPSA | 44.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|