About 8-sulfanylnaphthalene-1,2-diol
8-sulfanylnaphthalene-1,2-diol (PubChem CID 142855011) has the molecular formula C10H8O2S
and a molecular weight of 192.24 g/mol. Its IUPAC name is 8-sulfanylnaphthalene-1,2-diol.
Molecular Properties
| Compound Name | 8-sulfanylnaphthalene-1,2-diol |
| PubChem CID | 142855011 |
| Molecular Formula | C10H8O2S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 8-sulfanylnaphthalene-1,2-diol |
| SMILES | Oc1ccc2cccc(S)c2c1O |
| InChI | InChI=1S/C10H8O2S/c11-7-5-4-6-2-1-3-8(13)9(6)10(7)12/h1-5,11-13H |
| InChIKey | JDKCBZTUMHOWBN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 8-sulfanylnaphthalene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-sulfanylnaphthalene-1,2-diol?
The IUPAC name of 8-sulfanylnaphthalene-1,2-diol (CID 142855011) is 8-sulfanylnaphthalene-1,2-diol.
What is the SMILES notation for 8-sulfanylnaphthalene-1,2-diol?
The canonical SMILES for 8-sulfanylnaphthalene-1,2-diol is Oc1ccc2cccc(S)c2c1O.
What is the InChIKey of 8-sulfanylnaphthalene-1,2-diol?
The InChIKey is JDKCBZTUMHOWBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2S/c11-7-5-4-6-2-1-3-8(13)9(6)10(7)12/h1-5,11-13H.
What are the key properties of 8-sulfanylnaphthalene-1,2-diol?
8-sulfanylnaphthalene-1,2-diol has a molecular weight of 192.24 g/mol, XLogP of 2.54, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-sulfanylnaphthalene-1,2-diol is sourced from PubChem (CID 142855011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).