C10H9Cl2NO4 — CID 118461197
2-(2,5-dichloro-3,4-dihydroxyphenyl)-N-ethyl-2-oxoacetamide (PubChem CID 118461197) has the molecular formula C10H9Cl2NO4 and a molecular weight of 278.09 g/mol. Its IUPAC name is 2-(2,5-dichloro-3,4-dihydroxyphenyl)-N-ethyl-2-oxoacetamide.
| Compound Name | 2-(2,5-dichloro-3,4-dihydroxyphenyl)-N-ethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 118461197 |
| Molecular Formula | C10H9Cl2NO4 |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 2-(2,5-dichloro-3,4-dihydroxyphenyl)-N-ethyl-2-oxoacetamide |
| SMILES | CCNC(=O)C(=O)c1cc(Cl)c(O)c(O)c1Cl |
| InChI | InChI=1S/C10H9Cl2NO4/c1-2-13-10(17)7(14)4-3-5(11)8(15)9(16)6(4)12/h3,15-16H,2H2,1H3,(H,13,17) |
| InChIKey | JWQYVECXABPNNR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|