About [5-(hydroxymethyl)furan-2-yl]methanol;bis(6-methylheptanoic acid)
[5-(hydroxymethyl)furan-2-yl]methanol;bis(6-methylheptanoic acid) (PubChem CID 118471758) has the molecular formula C22H40O7
and a molecular weight of 416.56 g/mol. Its IUPAC name is [5-(hydroxymethyl)furan-2-yl]methanol;bis(6-methylheptanoic acid).
Molecular Properties
| Compound Name | [5-(hydroxymethyl)furan-2-yl]methanol;bis(6-methylheptanoic acid) |
| PubChem CID | 118471758 |
| Molecular Formula | C22H40O7 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | [5-(hydroxymethyl)furan-2-yl]methanol;bis(6-methylheptanoic acid) |
| SMILES | CC(C)CCCCC(=O)O.CC(C)CCCCC(=O)O.OCc1ccc(CO)o1 |
| InChI | InChI=1S/2C8H16O2.C6H8O3/c2*1-7(2)5-3-4-6-8(9)10;7-3-5-1-2-6(4-8)9-5/h2*7H,3-6H2,1-2H3,(H,9,10);1-2,7-8H,3-4H2 |
| InChIKey | MBYGCGVYJRYTAD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [5-(hydroxymethyl)furan-2-yl]methanol;bis(6-methylheptanoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hydroxymethyl)furan-2-yl]methanol;bis(6-methylheptanoic acid)?
The IUPAC name of [5-(hydroxymethyl)furan-2-yl]methanol;bis(6-methylheptanoic acid) (CID 118471758) is [5-(hydroxymethyl)furan-2-yl]methanol;bis(6-methylheptanoic acid).
What is the SMILES notation for [5-(hydroxymethyl)furan-2-yl]methanol;bis(6-methylheptanoic acid)?
The canonical SMILES for [5-(hydroxymethyl)furan-2-yl]methanol;bis(6-methylheptanoic acid) is CC(C)CCCCC(=O)O.CC(C)CCCCC(=O)O.OCc1ccc(CO)o1.
What is the InChIKey of [5-(hydroxymethyl)furan-2-yl]methanol;bis(6-methylheptanoic acid)?
The InChIKey is MBYGCGVYJRYTAD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H16O2.C6H8O3/c2*1-7(2)5-3-4-6-8(9)10;7-3-5-1-2-6(4-8)9-5/h2*7H,3-6H2,1-2H3,(H,9,10);1-2,7-8H,3-4H2.
What are the key properties of [5-(hydroxymethyl)furan-2-yl]methanol;bis(6-methylheptanoic acid)?
[5-(hydroxymethyl)furan-2-yl]methanol;bis(6-methylheptanoic acid) has a molecular weight of 416.56 g/mol, XLogP of 4.84, 12 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hydroxymethyl)furan-2-yl]methanol;bis(6-methylheptanoic acid) is sourced from PubChem (CID 118471758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).