C27H38O7 — CID 118474337
2-[(2E)-2-[(3aS,4S,5R,6aS)-4-[(3S,4S)-3-hydroxy-4-methylnona-1,6-diynyl]-5-[(2-methylpropan-2-yl)oxycarbonyloxy]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethoxy]acetic acid (PubChem CID 118474337) has the molecular formula C27H38O7 and a molecular weight of 474.59 g/mol. Its IUPAC name is 2-[(2E)-2-[(3aS,4S,5R,6aS)-4-[(3S,4S)-3-hydroxy-4-methylnona-1,6-diynyl]-5-[(2-methylpropan-2-yl)oxycarbonyloxy]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethoxy]acetic acid.
| Compound Name | 2-[(2E)-2-[(3aS,4S,5R,6aS)-4-[(3S,4S)-3-hydroxy-4-methylnona-1,6-diynyl]-5-[(2-methylpropan-2-yl)oxycarbonyloxy]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethoxy]acetic acid |
|---|---|
| PubChem CID | 118474337 |
| Molecular Formula | C27H38O7 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 2-[(2E)-2-[(3aS,4S,5R,6aS)-4-[(3S,4S)-3-hydroxy-4-methylnona-1,6-diynyl]-5-[(2-methylpropan-2-yl)oxycarbonyloxy]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethoxy]acetic acid |
| SMILES | CCC#CC[C@H](C)[C@H](O)C#C[C@@H]1[C@H]2C/C(=C/COCC(=O)O)C[C@H]2C[C@H]1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H38O7/c1-6-7-8-9-18(2)23(28)11-10-21-22-15-19(12-13-32-17-25(29)30)14-20(22)16-24(21)33-26(31)34-27(3,4)5/h12,18,20-24,28H,6,9,13-17H2,1-5H3,(H,29,30)/b19-12+/t18-,20-,21+,22-,23+,24+/m0/s1 |
| InChIKey | KWXJUZAXWKLFRH-KIPMXBRTSA-N |
| XLogP | 4.18 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|