C29H34N6O2S — CID 11848005
(6R)-N-[(1S)-2-amino-1-[3-[(1-methylimidazole-2-carbonyl)amino]phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide (PubChem CID 11848005) has the molecular formula C29H34N6O2S and a molecular weight of 530.70 g/mol. Its IUPAC name is (6R)-N-[(1S)-2-amino-1-[3-[(1-methylimidazole-2-carbonyl)amino]phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | (6R)-N-[(1S)-2-amino-1-[3-[(1-methylimidazole-2-carbonyl)amino]phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 11848005 |
| Molecular Formula | C29H34N6O2S |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | (6R)-N-[(1S)-2-amino-1-[3-[(1-methylimidazole-2-carbonyl)amino]phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
| SMILES | Cn1ccnc1C(=O)Nc1cccc([C@@H](CN)NC(=O)c2cc3cc4c(nc3s2)CC[C@@H](C(C)(C)C)C4)c1 |
| InChI | InChI=1S/C29H34N6O2S/c1-29(2,3)20-8-9-22-18(13-20)12-19-15-24(38-28(19)34-22)26(36)33-23(16-30)17-6-5-7-21(14-17)32-27(37)25-31-10-11-35(25)4/h5-7,10-12,14-15,20,23H,8-9,13,16,30H2,1-4H3,(H,32,37)(H,33,36)/t20-,23-/m1/s1 |
| InChIKey | YTRSLQJCDIADCC-NFBKMPQASA-N |
| XLogP | 4.86 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |