C14H24N4O2S2 — CID 118491416
ethyl 2-[(aminomethylamino)carbamothioylamino]-4-butyl-5-methylthiophene-3-carboxylate (PubChem CID 118491416) has the molecular formula C14H24N4O2S2 and a molecular weight of 344.51 g/mol. Its IUPAC name is ethyl 2-[(aminomethylamino)carbamothioylamino]-4-butyl-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(aminomethylamino)carbamothioylamino]-4-butyl-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 118491416 |
| Molecular Formula | C14H24N4O2S2 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | ethyl 2-[(aminomethylamino)carbamothioylamino]-4-butyl-5-methylthiophene-3-carboxylate |
| SMILES | CCCCc1c(C)sc(NC(=S)NNCN)c1C(=O)OCC |
| InChI | InChI=1S/C14H24N4O2S2/c1-4-6-7-10-9(3)22-12(11(10)13(19)20-5-2)17-14(21)18-16-8-15/h16H,4-8,15H2,1-3H3,(H2,17,18,21) |
| InChIKey | FZERIHBZBQMMFZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|