C27H28ClFN6O2 — CID 118499532
2-chloro-1-[6-[[5-fluoro-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]spiro[2H-indole-3,1'-cyclopropane]-1-yl]propan-1-one (PubChem CID 118499532) has the molecular formula C27H28ClFN6O2 and a molecular weight of 523.01 g/mol. Its IUPAC name is 2-chloro-1-[6-[[5-fluoro-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]spiro[2H-indole-3,1'-cyclopropane]-1-yl]propan-1-one.
| Compound Name | 2-chloro-1-[6-[[5-fluoro-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]spiro[2H-indole-3,1'-cyclopropane]-1-yl]propan-1-one |
|---|---|
| PubChem CID | 118499532 |
| Molecular Formula | C27H28ClFN6O2 |
| Molecular Weight | 523.01 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 2-chloro-1-[6-[[5-fluoro-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]spiro[2H-indole-3,1'-cyclopropane]-1-yl]propan-1-one |
| SMILES | CC(Cl)C(=O)N1CC2(CC2)c2ccc(Nc3nc(Nc4ccc(N5CCOCC5)cc4)ncc3F)cc21 |
| InChI | InChI=1S/C27H28ClFN6O2/c1-17(28)25(36)35-16-27(8-9-27)21-7-4-19(14-23(21)35)31-24-22(29)15-30-26(33-24)32-18-2-5-20(6-3-18)34-10-12-37-13-11-34/h2-7,14-15,17H,8-13,16H2,1H3,(H2,30,31,32,33) |
| InChIKey | UMQDEJOMQCEPEO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.01 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|