C31H36FN7O2 — CID 118507495
(E)-4-(dimethylamino)-1-[6-[[5-fluoro-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]spiro[2H-indole-3,1'-cyclobutane]-1-yl]but-2-en-1-one (PubChem CID 118507495) has the molecular formula C31H36FN7O2 and a molecular weight of 557.67 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-[6-[[5-fluoro-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]spiro[2H-indole-3,1'-cyclobutane]-1-yl]but-2-en-1-one.
| Compound Name | (E)-4-(dimethylamino)-1-[6-[[5-fluoro-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]spiro[2H-indole-3,1'-cyclobutane]-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 118507495 |
| Molecular Formula | C31H36FN7O2 |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | (E)-4-(dimethylamino)-1-[6-[[5-fluoro-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]spiro[2H-indole-3,1'-cyclobutane]-1-yl]but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1CC2(CCC2)c2ccc(Nc3nc(Nc4ccc(N5CCOCC5)cc4)ncc3F)cc21 |
| InChI | InChI=1S/C31H36FN7O2/c1-37(2)14-3-5-28(40)39-21-31(12-4-13-31)25-11-8-23(19-27(25)39)34-29-26(32)20-33-30(36-29)35-22-6-9-24(10-7-22)38-15-17-41-18-16-38/h3,5-11,19-20H,4,12-18,21H2,1-2H3,(H2,33,34,35,36)/b5-3+ |
| InChIKey | IRZCQJPVROESQG-HWKANZROSA-N |
| XLogP | 4.83 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|