About 6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one
6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one (PubChem CID 118509537) has the molecular formula C13H15FN2O3
and a molecular weight of 266.27 g/mol. Its IUPAC name is 6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one.
Molecular Properties
| Compound Name | 6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one |
| PubChem CID | 118509537 |
| Molecular Formula | C13H15FN2O3 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one |
| SMILES | CC(C)N1C(=O)C(C)(C)c2cc([N+](=O)[O-])c(F)cc21 |
| InChI | InChI=1S/C13H15FN2O3/c1-7(2)15-10-6-9(14)11(16(18)19)5-8(10)13(3,4)12(15)17/h5-7H,1-4H3 |
| InChIKey | ITGGLZZFZJCFOM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one?
The IUPAC name of 6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one (CID 118509537) is 6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one.
What is the SMILES notation for 6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one?
The canonical SMILES for 6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one is CC(C)N1C(=O)C(C)(C)c2cc([N+](=O)[O-])c(F)cc21.
What is the InChIKey of 6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one?
The InChIKey is ITGGLZZFZJCFOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN2O3/c1-7(2)15-10-6-9(14)11(16(18)19)5-8(10)13(3,4)12(15)17/h5-7H,1-4H3.
What are the key properties of 6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one?
6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one has a molecular weight of 266.27 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one is sourced from PubChem (CID 118509537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).