C13H15FN2O3 — CID 118509537
6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one (PubChem CID 118509537) has the molecular formula C13H15FN2O3 and a molecular weight of 266.27 g/mol. Its IUPAC name is 6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one.
| Compound Name | 6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one |
|---|---|
| PubChem CID | 118509537 |
| Molecular Formula | C13H15FN2O3 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 6-fluoro-3,3-dimethyl-5-nitro-1-propan-2-ylindol-2-one |
| SMILES | CC(C)N1C(=O)C(C)(C)c2cc([N+](=O)[O-])c(F)cc21 |
| InChI | InChI=1S/C13H15FN2O3/c1-7(2)15-10-6-9(14)11(16(18)19)5-8(10)13(3,4)12(15)17/h5-7H,1-4H3 |
| InChIKey | ITGGLZZFZJCFOM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|