C12H13FN2O3S — CID 142633002
7-fluoro-4-(2-methylpropyl)-6-nitro-1,4-benzothiazin-3-one (PubChem CID 142633002) has the molecular formula C12H13FN2O3S and a molecular weight of 284.31 g/mol. Its IUPAC name is 7-fluoro-4-(2-methylpropyl)-6-nitro-1,4-benzothiazin-3-one.
| Compound Name | 7-fluoro-4-(2-methylpropyl)-6-nitro-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 142633002 |
| Molecular Formula | C12H13FN2O3S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 7-fluoro-4-(2-methylpropyl)-6-nitro-1,4-benzothiazin-3-one |
| SMILES | CC(C)CN1C(=O)CSc2cc(F)c([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C12H13FN2O3S/c1-7(2)5-14-10-4-9(15(17)18)8(13)3-11(10)19-6-12(14)16/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | PFRVNLRVSPUIJV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|