About 4-(4,5-dimethoxy-2-nitrophenyl)-1-(2-methylpropyl)piperazin-2-one
4-(4,5-dimethoxy-2-nitrophenyl)-1-(2-methylpropyl)piperazin-2-one (PubChem CID 133498667) has the molecular formula C16H23N3O5
and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-(4,5-dimethoxy-2-nitrophenyl)-1-(2-methylpropyl)piperazin-2-one.
Molecular Properties
| Compound Name | 4-(4,5-dimethoxy-2-nitrophenyl)-1-(2-methylpropyl)piperazin-2-one |
| PubChem CID | 133498667 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 4-(4,5-dimethoxy-2-nitrophenyl)-1-(2-methylpropyl)piperazin-2-one |
| SMILES | COc1cc(N2CCN(CC(C)C)C(=O)C2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H23N3O5/c1-11(2)9-18-6-5-17(10-16(18)20)12-7-14(23-3)15(24-4)8-13(12)19(21)22/h7-8,11H,5-6,9-10H2,1-4H3 |
| InChIKey | QBEKTUOLTYWHSX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,5-dimethoxy-2-nitrophenyl)-1-(2-methylpropyl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dimethoxy-2-nitrophenyl)-1-(2-methylpropyl)piperazin-2-one?
The IUPAC name of 4-(4,5-dimethoxy-2-nitrophenyl)-1-(2-methylpropyl)piperazin-2-one (CID 133498667) is 4-(4,5-dimethoxy-2-nitrophenyl)-1-(2-methylpropyl)piperazin-2-one.
What is the SMILES notation for 4-(4,5-dimethoxy-2-nitrophenyl)-1-(2-methylpropyl)piperazin-2-one?
The canonical SMILES for 4-(4,5-dimethoxy-2-nitrophenyl)-1-(2-methylpropyl)piperazin-2-one is COc1cc(N2CCN(CC(C)C)C(=O)C2)c([N+](=O)[O-])cc1OC.
What is the InChIKey of 4-(4,5-dimethoxy-2-nitrophenyl)-1-(2-methylpropyl)piperazin-2-one?
The InChIKey is QBEKTUOLTYWHSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O5/c1-11(2)9-18-6-5-17(10-16(18)20)12-7-14(23-3)15(24-4)8-13(12)19(21)22/h7-8,11H,5-6,9-10H2,1-4H3.
What are the key properties of 4-(4,5-dimethoxy-2-nitrophenyl)-1-(2-methylpropyl)piperazin-2-one?
4-(4,5-dimethoxy-2-nitrophenyl)-1-(2-methylpropyl)piperazin-2-one has a molecular weight of 337.38 g/mol, XLogP of 1.92, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dimethoxy-2-nitrophenyl)-1-(2-methylpropyl)piperazin-2-one is sourced from PubChem (CID 133498667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).