C15H26N2O — CID 118516876
1-[1-(2,4-dimethylphenyl)-2-ethoxyethyl]-1,2,2-trimethylhydrazine (PubChem CID 118516876) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 1-[1-(2,4-dimethylphenyl)-2-ethoxyethyl]-1,2,2-trimethylhydrazine.
| Compound Name | 1-[1-(2,4-dimethylphenyl)-2-ethoxyethyl]-1,2,2-trimethylhydrazine |
|---|---|
| PubChem CID | 118516876 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 1-[1-(2,4-dimethylphenyl)-2-ethoxyethyl]-1,2,2-trimethylhydrazine |
| SMILES | CCOCC(c1ccc(C)cc1C)N(C)N(C)C |
| InChI | InChI=1S/C15H26N2O/c1-7-18-11-15(17(6)16(4)5)14-9-8-12(2)10-13(14)3/h8-10,15H,7,11H2,1-6H3 |
| InChIKey | IFWHBZDHSIMFAJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|