C14H23N3O2S — CID 118527407
3-(4-aminobutyl)-N-(azetidin-3-yl)-5-methylbenzenesulfonamide (PubChem CID 118527407) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 3-(4-aminobutyl)-N-(azetidin-3-yl)-5-methylbenzenesulfonamide.
| Compound Name | 3-(4-aminobutyl)-N-(azetidin-3-yl)-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 118527407 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3-(4-aminobutyl)-N-(azetidin-3-yl)-5-methylbenzenesulfonamide |
| SMILES | Cc1cc(CCCCN)cc(S(=O)(=O)NC2CNC2)c1 |
| InChI | InChI=1S/C14H23N3O2S/c1-11-6-12(4-2-3-5-15)8-14(7-11)20(18,19)17-13-9-16-10-13/h6-8,13,16-17H,2-5,9-10,15H2,1H3 |
| InChIKey | VWOLHIISEMYVRN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|