C16H27N3O2S — CID 134447036
3-(4-aminobutyl)-N-(azetidin-3-yl)-5-propan-2-ylbenzenesulfonamide (PubChem CID 134447036) has the molecular formula C16H27N3O2S and a molecular weight of 325.48 g/mol. Its IUPAC name is 3-(4-aminobutyl)-N-(azetidin-3-yl)-5-propan-2-ylbenzenesulfonamide.
| Compound Name | 3-(4-aminobutyl)-N-(azetidin-3-yl)-5-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 134447036 |
| Molecular Formula | C16H27N3O2S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 3-(4-aminobutyl)-N-(azetidin-3-yl)-5-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)c1cc(CCCCN)cc(S(=O)(=O)NC2CNC2)c1 |
| InChI | InChI=1S/C16H27N3O2S/c1-12(2)14-7-13(5-3-4-6-17)8-16(9-14)22(20,21)19-15-10-18-11-15/h7-9,12,15,18-19H,3-6,10-11,17H2,1-2H3 |
| InChIKey | DIPIBULMVKVYRJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|