C22H34N2 — CID 118533075
1-(2,5,7-trimethylcyclohepta-1,6-dien-1-yl)-3-[(4S)-2,4,6-trimethylcyclohexa-1,5-dien-1-yl]imidazolidine (PubChem CID 118533075) has the molecular formula C22H34N2 and a molecular weight of 326.53 g/mol. Its IUPAC name is 1-(2,5,7-trimethylcyclohepta-1,6-dien-1-yl)-3-[(4S)-2,4,6-trimethylcyclohexa-1,5-dien-1-yl]imidazolidine.
| Compound Name | 1-(2,5,7-trimethylcyclohepta-1,6-dien-1-yl)-3-[(4S)-2,4,6-trimethylcyclohexa-1,5-dien-1-yl]imidazolidine |
|---|---|
| PubChem CID | 118533075 |
| Molecular Formula | C22H34N2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | 1-(2,5,7-trimethylcyclohepta-1,6-dien-1-yl)-3-[(4S)-2,4,6-trimethylcyclohexa-1,5-dien-1-yl]imidazolidine |
| SMILES | CC1=CC(C)CCC(C)=C1N1CCN(C2=C(C)C[C@H](C)C=C2C)C1 |
| InChI | InChI=1S/C22H34N2/c1-15-7-8-17(3)21(18(4)11-15)23-9-10-24(14-23)22-19(5)12-16(2)13-20(22)6/h11-12,15-16H,7-10,13-14H2,1-6H3/t15?,16-/m1/s1 |
| InChIKey | DZVZHQZNYXUJJY-OEMAIJDKSA-N |
| XLogP | 5.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |