C14H19FO8 — CID 118533729
2-fluoro-2-[(Z)-4-hexan-2-yloxy-4-oxobut-2-enoyl]oxybutanedioic acid (PubChem CID 118533729) has the molecular formula C14H19FO8 and a molecular weight of 334.30 g/mol. Its IUPAC name is 2-fluoro-2-[(Z)-4-hexan-2-yloxy-4-oxobut-2-enoyl]oxybutanedioic acid.
| Compound Name | 2-fluoro-2-[(Z)-4-hexan-2-yloxy-4-oxobut-2-enoyl]oxybutanedioic acid |
|---|---|
| PubChem CID | 118533729 |
| Molecular Formula | C14H19FO8 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-fluoro-2-[(Z)-4-hexan-2-yloxy-4-oxobut-2-enoyl]oxybutanedioic acid |
| SMILES | CCCCC(C)OC(=O)/C=C\C(=O)OC(F)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H19FO8/c1-3-4-5-9(2)22-11(18)6-7-12(19)23-14(15,13(20)21)8-10(16)17/h6-7,9H,3-5,8H2,1-2H3,(H,16,17)(H,20,21)/b7-6- |
| InChIKey | YGNMAKWNOZCZRD-SREVYHEPSA-N |
| XLogP | 1.43 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|