C24H19F2NO3 — CID 118535565
1-(4-fluorophenyl)-2-[3-(4-fluorophenyl)-6-(hydroxymethyl)-4-methoxyindol-1-yl]ethanone (PubChem CID 118535565) has the molecular formula C24H19F2NO3 and a molecular weight of 407.42 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[3-(4-fluorophenyl)-6-(hydroxymethyl)-4-methoxyindol-1-yl]ethanone.
| Compound Name | 1-(4-fluorophenyl)-2-[3-(4-fluorophenyl)-6-(hydroxymethyl)-4-methoxyindol-1-yl]ethanone |
|---|---|
| PubChem CID | 118535565 |
| Molecular Formula | C24H19F2NO3 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[3-(4-fluorophenyl)-6-(hydroxymethyl)-4-methoxyindol-1-yl]ethanone |
| SMILES | COc1cc(CO)cc2c1c(-c1ccc(F)cc1)cn2CC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H19F2NO3/c1-30-23-11-15(14-28)10-21-24(23)20(16-2-6-18(25)7-3-16)12-27(21)13-22(29)17-4-8-19(26)9-5-17/h2-12,28H,13-14H2,1H3 |
| InChIKey | NWBVRSDGOBUDSW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |