C14H15F3N4O3 — CID 118538250
4-(hydroxyamino)-4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-one (PubChem CID 118538250) has the molecular formula C14H15F3N4O3 and a molecular weight of 344.29 g/mol. Its IUPAC name is 4-(hydroxyamino)-4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-one.
| Compound Name | 4-(hydroxyamino)-4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-one |
|---|---|
| PubChem CID | 118538250 |
| Molecular Formula | C14H15F3N4O3 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 4-(hydroxyamino)-4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-one |
| SMILES | CO/N=C(\C)C1(NO)C(=O)N(C)N=C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H15F3N4O3/c1-8(19-24-3)13(20-23)11(18-21(2)12(13)22)9-4-6-10(7-5-9)14(15,16)17/h4-7,20,23H,1-3H3/b19-8+ |
| InChIKey | KMXQKPFTGYPRBI-UFWORHAWSA-N |
| XLogP | 1.62 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|