C15H29N3 — CID 118539201
1-N',1-N",1-N"-tris(prop-2-enyl)hexane-1,1,1-triamine (PubChem CID 118539201) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is 1-N',1-N",1-N"-tris(prop-2-enyl)hexane-1,1,1-triamine.
| Compound Name | 1-N',1-N",1-N"-tris(prop-2-enyl)hexane-1,1,1-triamine |
|---|---|
| PubChem CID | 118539201 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | 1-N',1-N",1-N"-tris(prop-2-enyl)hexane-1,1,1-triamine |
| SMILES | C=CCNC(N)(CCCCC)N(CC=C)CC=C |
| InChI | InChI=1S/C15H29N3/c1-5-9-10-11-15(16,17-12-6-2)18(13-7-3)14-8-4/h6-8,17H,2-5,9-14,16H2,1H3 |
| InChIKey | JHSFTFYNWAPHHS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|