C13H28Cl2N2 — CID 139891240
3-ethyl-3-N,3-N-bis(prop-2-enyl)pentane-1,3-diamine;dihydrochloride (PubChem CID 139891240) has the molecular formula C13H28Cl2N2 and a molecular weight of 283.29 g/mol. Its IUPAC name is 3-ethyl-3-N,3-N-bis(prop-2-enyl)pentane-1,3-diamine;dihydrochloride.
| Compound Name | 3-ethyl-3-N,3-N-bis(prop-2-enyl)pentane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 139891240 |
| Molecular Formula | C13H28Cl2N2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 3-ethyl-3-N,3-N-bis(prop-2-enyl)pentane-1,3-diamine;dihydrochloride |
| SMILES | C=CCN(CC=C)C(CC)(CC)CCN.Cl.Cl |
| InChI | InChI=1S/C13H26N2.2ClH/c1-5-11-15(12-6-2)13(7-3,8-4)9-10-14;;/h5-6H,1-2,7-12,14H2,3-4H3;2*1H |
| InChIKey | BCJGKFAPADXMJA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|