C38H50O10 — CID 118553458
[3-methyl-4-[[4-(6-prop-2-enylperoxyhexoxy)phenyl]methylperoxy]phenyl] 4-[3-(3-methoxypropoxy)propoxymethyl]benzoate (PubChem CID 118553458) has the molecular formula C38H50O10 and a molecular weight of 666.81 g/mol. Its IUPAC name is [3-methyl-4-[[4-(6-prop-2-enylperoxyhexoxy)phenyl]methylperoxy]phenyl] 4-[3-(3-methoxypropoxy)propoxymethyl]benzoate.
| Compound Name | [3-methyl-4-[[4-(6-prop-2-enylperoxyhexoxy)phenyl]methylperoxy]phenyl] 4-[3-(3-methoxypropoxy)propoxymethyl]benzoate |
|---|---|
| PubChem CID | 118553458 |
| Molecular Formula | C38H50O10 |
| Molecular Weight | 666.81 g/mol |
| Exact Mass | 666.34 |
| IUPAC Name | [3-methyl-4-[[4-(6-prop-2-enylperoxyhexoxy)phenyl]methylperoxy]phenyl] 4-[3-(3-methoxypropoxy)propoxymethyl]benzoate |
| SMILES | C=CCOOCCCCCCOc1ccc(COOc2ccc(OC(=O)c3ccc(COCCCOCCCOC)cc3)cc2C)cc1 |
| InChI | InChI=1S/C38H50O10/c1-4-21-44-45-27-8-6-5-7-26-43-35-17-13-33(14-18-35)30-46-48-37-20-19-36(28-31(37)2)47-38(39)34-15-11-32(12-16-34)29-42-25-10-24-41-23-9-22-40-3/h4,11-20,28H,1,5-10,21-27,29-30H2,2-3H3 |
| InChIKey | KJVSYNIKMQUVPP-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.81 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|