C35H44O10 — CID 121480470
1-[[4-[1-[2-(2-methoxyethoxy)ethoxy]ethenyl]phenoxy]methoxy]-2-methyl-4-[[4-(4-prop-2-enylperoxybutoxy)phenoxy]methoxy]benzene (PubChem CID 121480470) has the molecular formula C35H44O10 and a molecular weight of 624.73 g/mol. Its IUPAC name is 1-[[4-[1-[2-(2-methoxyethoxy)ethoxy]ethenyl]phenoxy]methoxy]-2-methyl-4-[[4-(4-prop-2-enylperoxybutoxy)phenoxy]methoxy]benzene.
| Compound Name | 1-[[4-[1-[2-(2-methoxyethoxy)ethoxy]ethenyl]phenoxy]methoxy]-2-methyl-4-[[4-(4-prop-2-enylperoxybutoxy)phenoxy]methoxy]benzene |
|---|---|
| PubChem CID | 121480470 |
| Molecular Formula | C35H44O10 |
| Molecular Weight | 624.73 g/mol |
| Exact Mass | 624.29 |
| IUPAC Name | 1-[[4-[1-[2-(2-methoxyethoxy)ethoxy]ethenyl]phenoxy]methoxy]-2-methyl-4-[[4-(4-prop-2-enylperoxybutoxy)phenoxy]methoxy]benzene |
| SMILES | C=CCOOCCCCOc1ccc(OCOc2ccc(OCOc3ccc(C(=C)OCCOCCOC)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C35H44O10/c1-5-18-44-45-20-7-6-19-39-31-12-14-33(15-13-31)40-26-42-34-16-17-35(28(2)25-34)43-27-41-32-10-8-30(9-11-32)29(3)38-24-23-37-22-21-36-4/h5,8-17,25H,1,3,6-7,18-24,26-27H2,2,4H3 |
| InChIKey | DFVUSNSPMFUYLG-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.73 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|