About (3R,5R)-5-amino-2-[(dimethylamino)methyl]oxane-3,4-diol
(3R,5R)-5-amino-2-[(dimethylamino)methyl]oxane-3,4-diol (PubChem CID 118554665) has the molecular formula C8H18N2O3
and a molecular weight of 190.24 g/mol. Its IUPAC name is (3R,5R)-5-amino-2-[(dimethylamino)methyl]oxane-3,4-diol.
Molecular Properties
| Compound Name | (3R,5R)-5-amino-2-[(dimethylamino)methyl]oxane-3,4-diol |
| PubChem CID | 118554665 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | (3R,5R)-5-amino-2-[(dimethylamino)methyl]oxane-3,4-diol |
| SMILES | CN(C)CC1OC[C@@H](N)C(O)[C@H]1O |
| InChI | InChI=1S/C8H18N2O3/c1-10(2)3-6-8(12)7(11)5(9)4-13-6/h5-8,11-12H,3-4,9H2,1-2H3/t5-,6?,7?,8+/m1/s1 |
| InChIKey | JLDHHCAKOGDHLD-CQRKAFIDSA-N |
| XLogP | -2.00 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R,5R)-5-amino-2-[(dimethylamino)methyl]oxane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5R)-5-amino-2-[(dimethylamino)methyl]oxane-3,4-diol?
The IUPAC name of (3R,5R)-5-amino-2-[(dimethylamino)methyl]oxane-3,4-diol (CID 118554665) is (3R,5R)-5-amino-2-[(dimethylamino)methyl]oxane-3,4-diol.
What is the SMILES notation for (3R,5R)-5-amino-2-[(dimethylamino)methyl]oxane-3,4-diol?
The canonical SMILES for (3R,5R)-5-amino-2-[(dimethylamino)methyl]oxane-3,4-diol is CN(C)CC1OC[C@@H](N)C(O)[C@H]1O.
What is the InChIKey of (3R,5R)-5-amino-2-[(dimethylamino)methyl]oxane-3,4-diol?
The InChIKey is JLDHHCAKOGDHLD-CQRKAFIDSA-N. The full InChI is InChI=1S/C8H18N2O3/c1-10(2)3-6-8(12)7(11)5(9)4-13-6/h5-8,11-12H,3-4,9H2,1-2H3/t5-,6?,7?,8+/m1/s1.
What are the key properties of (3R,5R)-5-amino-2-[(dimethylamino)methyl]oxane-3,4-diol?
(3R,5R)-5-amino-2-[(dimethylamino)methyl]oxane-3,4-diol has a molecular weight of 190.24 g/mol, XLogP of -2.00, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5R)-5-amino-2-[(dimethylamino)methyl]oxane-3,4-diol is sourced from PubChem (CID 118554665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).