C19H31NO2 — CID 122365196
(2S,3S,4R)-4-amino-2-[2-(3-heptylphenyl)ethyl]oxolan-3-ol (PubChem CID 122365196) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is (2S,3S,4R)-4-amino-2-[2-(3-heptylphenyl)ethyl]oxolan-3-ol.
| Compound Name | (2S,3S,4R)-4-amino-2-[2-(3-heptylphenyl)ethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 122365196 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | (2S,3S,4R)-4-amino-2-[2-(3-heptylphenyl)ethyl]oxolan-3-ol |
| SMILES | CCCCCCCc1cccc(CC[C@@H]2OC[C@@H](N)[C@@H]2O)c1 |
| InChI | InChI=1S/C19H31NO2/c1-2-3-4-5-6-8-15-9-7-10-16(13-15)11-12-18-19(21)17(20)14-22-18/h7,9-10,13,17-19,21H,2-6,8,11-12,14,20H2,1H3/t17-,18+,19+/m1/s1 |
| InChIKey | MVRQVIKAUXNSBA-QYZOEREBSA-N |
| XLogP | 3.22 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|