About (E)-2-cyano-3-(3,6-dichloro-2-pyridinyl)-N-(1-phenylcyclopentyl)prop-2-enamide
(E)-2-cyano-3-(3,6-dichloro-2-pyridinyl)-N-(1-phenylcyclopentyl)prop-2-enamide (PubChem CID 118559684) has the molecular formula C20H17Cl2N3O
and a molecular weight of 386.28 g/mol. Its IUPAC name is (E)-2-cyano-3-(3,6-dichloro-2-pyridinyl)-N-(1-phenylcyclopentyl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-2-cyano-3-(3,6-dichloro-2-pyridinyl)-N-(1-phenylcyclopentyl)prop-2-enamide |
| PubChem CID | 118559684 |
| Molecular Formula | C20H17Cl2N3O |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | (E)-2-cyano-3-(3,6-dichloro-2-pyridinyl)-N-(1-phenylcyclopentyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1nc(Cl)ccc1Cl)C(=O)NC1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C20H17Cl2N3O/c21-16-8-9-18(22)24-17(16)12-14(13-23)19(26)25-20(10-4-5-11-20)15-6-2-1-3-7-15/h1-3,6-9,12H,4-5,10-11H2,(H,25,26)/b14-12+ |
| InChIKey | ROJWLTXUNGPGJO-WYMLVPIESA-N |
| XLogP | 4.88 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-cyano-3-(3,6-dichloro-2-pyridinyl)-N-(1-phenylcyclopentyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-cyano-3-(3,6-dichloro-2-pyridinyl)-N-(1-phenylcyclopentyl)prop-2-enamide?
The IUPAC name of (E)-2-cyano-3-(3,6-dichloro-2-pyridinyl)-N-(1-phenylcyclopentyl)prop-2-enamide (CID 118559684) is (E)-2-cyano-3-(3,6-dichloro-2-pyridinyl)-N-(1-phenylcyclopentyl)prop-2-enamide.
What is the SMILES notation for (E)-2-cyano-3-(3,6-dichloro-2-pyridinyl)-N-(1-phenylcyclopentyl)prop-2-enamide?
The canonical SMILES for (E)-2-cyano-3-(3,6-dichloro-2-pyridinyl)-N-(1-phenylcyclopentyl)prop-2-enamide is N#C/C(=C\c1nc(Cl)ccc1Cl)C(=O)NC1(c2ccccc2)CCCC1.
What is the InChIKey of (E)-2-cyano-3-(3,6-dichloro-2-pyridinyl)-N-(1-phenylcyclopentyl)prop-2-enamide?
The InChIKey is ROJWLTXUNGPGJO-WYMLVPIESA-N. The full InChI is InChI=1S/C20H17Cl2N3O/c21-16-8-9-18(22)24-17(16)12-14(13-23)19(26)25-20(10-4-5-11-20)15-6-2-1-3-7-15/h1-3,6-9,12H,4-5,10-11H2,(H,25,26)/b14-12+.
What are the key properties of (E)-2-cyano-3-(3,6-dichloro-2-pyridinyl)-N-(1-phenylcyclopentyl)prop-2-enamide?
(E)-2-cyano-3-(3,6-dichloro-2-pyridinyl)-N-(1-phenylcyclopentyl)prop-2-enamide has a molecular weight of 386.28 g/mol, XLogP of 4.88, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-cyano-3-(3,6-dichloro-2-pyridinyl)-N-(1-phenylcyclopentyl)prop-2-enamide is sourced from PubChem (CID 118559684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).