C20H17ClFN3O — CID 118559595
(E)-3-(5-chloro-3-fluoro-2-pyridinyl)-2-cyano-N-(1-phenylcyclopentyl)prop-2-enamide (PubChem CID 118559595) has the molecular formula C20H17ClFN3O and a molecular weight of 369.83 g/mol. Its IUPAC name is (E)-3-(5-chloro-3-fluoro-2-pyridinyl)-2-cyano-N-(1-phenylcyclopentyl)prop-2-enamide.
| Compound Name | (E)-3-(5-chloro-3-fluoro-2-pyridinyl)-2-cyano-N-(1-phenylcyclopentyl)prop-2-enamide |
|---|---|
| PubChem CID | 118559595 |
| Molecular Formula | C20H17ClFN3O |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (E)-3-(5-chloro-3-fluoro-2-pyridinyl)-2-cyano-N-(1-phenylcyclopentyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ncc(Cl)cc1F)C(=O)NC1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C20H17ClFN3O/c21-16-11-17(22)18(24-13-16)10-14(12-23)19(26)25-20(8-4-5-9-20)15-6-2-1-3-7-15/h1-3,6-7,10-11,13H,4-5,8-9H2,(H,25,26)/b14-10+ |
| InChIKey | XNBCSCMCCAMRQB-GXDHUFHOSA-N |
| XLogP | 4.37 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|