C27H22FN3O3 — CID 158602808
carbon dioxide;(E)-2-cyano-3-[6-(2-fluorophenyl)-2-pyridinyl]-N-(1-phenylcyclopentyl)prop-2-enamide (PubChem CID 158602808) has the molecular formula C27H22FN3O3 and a molecular weight of 455.49 g/mol. Its IUPAC name is carbon dioxide;(E)-2-cyano-3-[6-(2-fluorophenyl)-2-pyridinyl]-N-(1-phenylcyclopentyl)prop-2-enamide.
| Compound Name | carbon dioxide;(E)-2-cyano-3-[6-(2-fluorophenyl)-2-pyridinyl]-N-(1-phenylcyclopentyl)prop-2-enamide |
|---|---|
| PubChem CID | 158602808 |
| Molecular Formula | C27H22FN3O3 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | carbon dioxide;(E)-2-cyano-3-[6-(2-fluorophenyl)-2-pyridinyl]-N-(1-phenylcyclopentyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cccc(-c2ccccc2F)n1)C(=O)NC1(c2ccccc2)CCCC1.O=C=O |
| InChI | InChI=1S/C26H22FN3O.CO2/c27-23-13-5-4-12-22(23)24-14-8-11-21(29-24)17-19(18-28)25(31)30-26(15-6-7-16-26)20-9-2-1-3-10-20;2-1-3/h1-5,8-14,17H,6-7,15-16H2,(H,30,31);/b19-17+; |
| InChIKey | HVVUUHOKMLJRGG-ZJSKVYKZSA-N |
| XLogP | 4.80 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|