C26H26BrN3O2 — CID 158015362
(E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[1-[4-(6-hydroxyhex-1-ynyl)phenyl]cyclopentyl]prop-2-enamide (PubChem CID 158015362) has the molecular formula C26H26BrN3O2 and a molecular weight of 492.42 g/mol. Its IUPAC name is (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[1-[4-(6-hydroxyhex-1-ynyl)phenyl]cyclopentyl]prop-2-enamide.
| Compound Name | (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[1-[4-(6-hydroxyhex-1-ynyl)phenyl]cyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 158015362 |
| Molecular Formula | C26H26BrN3O2 |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[1-[4-(6-hydroxyhex-1-ynyl)phenyl]cyclopentyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cccc(Br)n1)C(=O)NC1(c2ccc(C#CCCCCO)cc2)CCCC1 |
| InChI | InChI=1S/C26H26BrN3O2/c27-24-10-7-9-23(29-24)18-21(19-28)25(32)30-26(15-4-5-16-26)22-13-11-20(12-14-22)8-3-1-2-6-17-31/h7,9-14,18,31H,1-2,4-6,15-17H2,(H,30,32)/b21-18+ |
| InChIKey | FFJXQTMDQKIRDU-DYTRJAOYSA-N |
| XLogP | 4.85 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|