C26H23N3O — CID 126726893
(E)-2-cyano-N-(1-phenylcyclopentyl)-3-(6-phenyl-2-pyridinyl)prop-2-enamide (PubChem CID 126726893) has the molecular formula C26H23N3O and a molecular weight of 393.49 g/mol. Its IUPAC name is (E)-2-cyano-N-(1-phenylcyclopentyl)-3-(6-phenyl-2-pyridinyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(1-phenylcyclopentyl)-3-(6-phenyl-2-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 126726893 |
| Molecular Formula | C26H23N3O |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | (E)-2-cyano-N-(1-phenylcyclopentyl)-3-(6-phenyl-2-pyridinyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cccc(-c2ccccc2)n1)C(=O)NC1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C26H23N3O/c27-19-21(18-23-14-9-15-24(28-23)20-10-3-1-4-11-20)25(30)29-26(16-7-8-17-26)22-12-5-2-6-13-22/h1-6,9-15,18H,7-8,16-17H2,(H,29,30)/b21-18+ |
| InChIKey | FHGDZWLHUKZSBZ-DYTRJAOYSA-N |
| XLogP | 5.24 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|