C27H30N4O6 — CID 118561390
2-[4-(hexylamino)-3-(pyrrolidine-2-carbonylcarbamoyl)phenyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 118561390) has the molecular formula C27H30N4O6 and a molecular weight of 506.56 g/mol. Its IUPAC name is 2-[4-(hexylamino)-3-(pyrrolidine-2-carbonylcarbamoyl)phenyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[4-(hexylamino)-3-(pyrrolidine-2-carbonylcarbamoyl)phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 118561390 |
| Molecular Formula | C27H30N4O6 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 2-[4-(hexylamino)-3-(pyrrolidine-2-carbonylcarbamoyl)phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | CCCCCCNc1ccc(N2C(=O)c3ccc(C(=O)O)cc3C2=O)cc1C(=O)NC(=O)C1CCCN1 |
| InChI | InChI=1S/C27H30N4O6/c1-2-3-4-5-12-28-21-11-9-17(15-20(21)23(32)30-24(33)22-7-6-13-29-22)31-25(34)18-10-8-16(27(36)37)14-19(18)26(31)35/h8-11,14-15,22,28-29H,2-7,12-13H2,1H3,(H,36,37)(H,30,32,33) |
| InChIKey | DJOPGCAWQQOVRP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|