C25H34BrNO3 — CID 118563192
butyl (2S)-2-[3-amino-4-bromo-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 118563192) has the molecular formula C25H34BrNO3 and a molecular weight of 476.46 g/mol. Its IUPAC name is butyl (2S)-2-[3-amino-4-bromo-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate.
| Compound Name | butyl (2S)-2-[3-amino-4-bromo-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 118563192 |
| Molecular Formula | C25H34BrNO3 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | butyl (2S)-2-[3-amino-4-bromo-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | CCCCOC(=O)[C@@H](OC(C)(C)C)c1c(C)c(N)c(Br)c(C)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C25H34BrNO3/c1-8-9-14-29-24(28)23(30-25(5,6)7)20-17(4)22(27)21(26)16(3)19(20)18-12-10-15(2)11-13-18/h10-13,23H,8-9,14,27H2,1-7H3/t23-/m0/s1 |
| InChIKey | FVBRNLXJQIXLAT-QHCPKHFHSA-N |
| XLogP | 6.82 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|