C15H22BrNO3 — CID 90377381
methyl (2S)-2-(5-amino-2-bromo-3,6-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 90377381) has the molecular formula C15H22BrNO3 and a molecular weight of 344.25 g/mol. Its IUPAC name is methyl (2S)-2-(5-amino-2-bromo-3,6-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate.
| Compound Name | methyl (2S)-2-(5-amino-2-bromo-3,6-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 90377381 |
| Molecular Formula | C15H22BrNO3 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | methyl (2S)-2-(5-amino-2-bromo-3,6-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | COC(=O)[C@@H](OC(C)(C)C)c1c(C)c(N)cc(C)c1Br |
| InChI | InChI=1S/C15H22BrNO3/c1-8-7-10(17)9(2)11(12(8)16)13(14(18)19-6)20-15(3,4)5/h7,13H,17H2,1-6H3/t13-/m0/s1 |
| InChIKey | ZXXFZSGNEWELFA-ZDUSSCGKSA-N |
| XLogP | 3.68 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|